C37H39N3O4 — CID 23647401
5-(2-acetylphenyl)-3-N-[(2S,3R)-3-hydroxy-1-phenyl-4-(prop-2-enylamino)butan-2-yl]-1-N-[(1R)-1-phenylethyl]benzene-1,3-dicarboxamide (PubChem CID 23647401) has the molecular formula C37H39N3O4 and a molecular weight of 589.74 g/mol. Its IUPAC name is 5-(2-acetylphenyl)-3-N-[(2S,3R)-3-hydroxy-1-phenyl-4-(prop-2-enylamino)butan-2-yl]-1-N-[(1R)-1-phenylethyl]benzene-1,3-dicarboxamide.
| Compound Name | 5-(2-acetylphenyl)-3-N-[(2S,3R)-3-hydroxy-1-phenyl-4-(prop-2-enylamino)butan-2-yl]-1-N-[(1R)-1-phenylethyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 23647401 |
| Molecular Formula | C37H39N3O4 |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | 5-(2-acetylphenyl)-3-N-[(2S,3R)-3-hydroxy-1-phenyl-4-(prop-2-enylamino)butan-2-yl]-1-N-[(1R)-1-phenylethyl]benzene-1,3-dicarboxamide |
| SMILES | C=CCNC[C@@H](O)[C@H](Cc1ccccc1)NC(=O)c1cc(C(=O)N[C@H](C)c2ccccc2)cc(-c2ccccc2C(C)=O)c1 |
| InChI | InChI=1S/C37H39N3O4/c1-4-19-38-24-35(42)34(20-27-13-7-5-8-14-27)40-37(44)31-22-29(33-18-12-11-17-32(33)26(3)41)21-30(23-31)36(43)39-25(2)28-15-9-6-10-16-28/h4-18,21-23,25,34-35,38,42H,1,19-20,24H2,2-3H3,(H,39,43)(H,40,44)/t25-,34+,35-/m1/s1 |
| InChIKey | GULAPJDRPMVCLU-XOUBVTBXSA-N |
| XLogP | 5.52 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|