C30H44N4O4S — CID 23647411
(2S)-2-[[17-[methyl(methylsulfonyl)amino]-2-oxo-3-azatricyclo[13.3.1.16,10]icosa-1(18),6,8,10(20),15(19),16-hexaen-4-yl]methylamino]-N-(2-methylpropyl)butanamide (PubChem CID 23647411) has the molecular formula C30H44N4O4S and a molecular weight of 556.77 g/mol. Its IUPAC name is (2S)-2-[[17-[methyl(methylsulfonyl)amino]-2-oxo-3-azatricyclo[13.3.1.16,10]icosa-1(18),6,8,10(20),15(19),16-hexaen-4-yl]methylamino]-N-(2-methylpropyl)butanamide.
| Compound Name | (2S)-2-[[17-[methyl(methylsulfonyl)amino]-2-oxo-3-azatricyclo[13.3.1.16,10]icosa-1(18),6,8,10(20),15(19),16-hexaen-4-yl]methylamino]-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 23647411 |
| Molecular Formula | C30H44N4O4S |
| Molecular Weight | 556.77 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | (2S)-2-[[17-[methyl(methylsulfonyl)amino]-2-oxo-3-azatricyclo[13.3.1.16,10]icosa-1(18),6,8,10(20),15(19),16-hexaen-4-yl]methylamino]-N-(2-methylpropyl)butanamide |
| SMILES | CC[C@H](NCC1Cc2cccc(c2)CCCCc2cc(cc(N(C)S(C)(=O)=O)c2)C(=O)N1)C(=O)NCC(C)C |
| InChI | InChI=1S/C30H44N4O4S/c1-6-28(30(36)32-19-21(2)3)31-20-26-16-23-13-9-12-22(14-23)10-7-8-11-24-15-25(29(35)33-26)18-27(17-24)34(4)39(5,37)38/h9,12-15,17-18,21,26,28,31H,6-8,10-11,16,19-20H2,1-5H3,(H,32,36)(H,33,35)/t26?,28-/m0/s1 |
| InChIKey | ABGNOCQONIAVFH-RXBHZZDJSA-N |
| XLogP | 3.44 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.77 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |