C25H17Cl4N3O3 — CID 23647535
2-[(2,4-dichloro-6-methylpyridine-3-carbonyl)amino]-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid (PubChem CID 23647535) has the molecular formula C25H17Cl4N3O3 and a molecular weight of 549.24 g/mol. Its IUPAC name is 2-[(2,4-dichloro-6-methylpyridine-3-carbonyl)amino]-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid.
| Compound Name | 2-[(2,4-dichloro-6-methylpyridine-3-carbonyl)amino]-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 23647535 |
| Molecular Formula | C25H17Cl4N3O3 |
| Molecular Weight | 549.24 g/mol |
| Exact Mass | 547.00 |
| IUPAC Name | 2-[(2,4-dichloro-6-methylpyridine-3-carbonyl)amino]-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid |
| SMILES | Cc1cc(Cl)c(C(=O)NC(Cc2ccc3nc(-c4c(Cl)cccc4Cl)ccc3c2)C(=O)O)c(Cl)n1 |
| InChI | InChI=1S/C25H17Cl4N3O3/c1-12-9-17(28)22(23(29)30-12)24(33)32-20(25(34)35)11-13-5-7-18-14(10-13)6-8-19(31-18)21-15(26)3-2-4-16(21)27/h2-10,20H,11H2,1H3,(H,32,33)(H,34,35) |
| InChIKey | VQROSQYIAGWBBN-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.24 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|