About 2-benzamido-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid
2-benzamido-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid (PubChem CID 23647536) has the molecular formula C25H18Cl2N2O3
and a molecular weight of 465.34 g/mol. Its IUPAC name is 2-benzamido-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid.
Molecular Properties
| Compound Name | 2-benzamido-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid |
| PubChem CID | 23647536 |
| Molecular Formula | C25H18Cl2N2O3 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 2-benzamido-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid |
| SMILES | O=C(NC(Cc1ccc2nc(-c3c(Cl)cccc3Cl)ccc2c1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C25H18Cl2N2O3/c26-18-7-4-8-19(27)23(18)21-12-10-17-13-15(9-11-20(17)28-21)14-22(25(31)32)29-24(30)16-5-2-1-3-6-16/h1-13,22H,14H2,(H,29,30)(H,31,32) |
| InChIKey | TYCBCXLVOZIZMM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzamido-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzamido-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid?
The IUPAC name of 2-benzamido-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid (CID 23647536) is 2-benzamido-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid.
What is the SMILES notation for 2-benzamido-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid?
The canonical SMILES for 2-benzamido-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid is O=C(NC(Cc1ccc2nc(-c3c(Cl)cccc3Cl)ccc2c1)C(=O)O)c1ccccc1.
What is the InChIKey of 2-benzamido-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid?
The InChIKey is TYCBCXLVOZIZMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18Cl2N2O3/c26-18-7-4-8-19(27)23(18)21-12-10-17-13-15(9-11-20(17)28-21)14-22(25(31)32)29-24(30)16-5-2-1-3-6-16/h1-13,22H,14H2,(H,29,30)(H,31,32).
What are the key properties of 2-benzamido-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid?
2-benzamido-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid has a molecular weight of 465.34 g/mol, XLogP of 5.63, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamido-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid is sourced from PubChem (CID 23647536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).