C27H29Cl3N6O — CID 23647649
4-(2-chlorophenyl)-8-(2,6-dichlorophenyl)-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one (PubChem CID 23647649) has the molecular formula C27H29Cl3N6O and a molecular weight of 559.93 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-8-(2,6-dichlorophenyl)-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one.
| Compound Name | 4-(2-chlorophenyl)-8-(2,6-dichlorophenyl)-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 23647649 |
| Molecular Formula | C27H29Cl3N6O |
| Molecular Weight | 559.93 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | 4-(2-chlorophenyl)-8-(2,6-dichlorophenyl)-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one |
| SMILES | CC1(C)CC(Nc2nc(-c3ccccc3Cl)c3c(n2)N(c2c(Cl)cccc2Cl)C(=O)NC3)CC(C)(C)N1 |
| InChI | InChI=1S/C27H29Cl3N6O/c1-26(2)12-15(13-27(3,4)35-26)32-24-33-21(16-8-5-6-9-18(16)28)17-14-31-25(37)36(23(17)34-24)22-19(29)10-7-11-20(22)30/h5-11,15,35H,12-14H2,1-4H3,(H,31,37)(H,32,33,34) |
| InChIKey | KRVICYSFUWOTBR-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.93 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |