About ethyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-methylsulfanylpentanoyl]amino]propanoate
ethyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-methylsulfanylpentanoyl]amino]propanoate (PubChem CID 23647751) has the molecular formula C11H22N2O4S
and a molecular weight of 278.37 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-methylsulfanylpentanoyl]amino]propanoate.
Molecular Properties
| Compound Name | ethyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-methylsulfanylpentanoyl]amino]propanoate |
| PubChem CID | 23647751 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | ethyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-methylsulfanylpentanoyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NC(=O)[C@@H](O)[C@H](N)CCSC |
| InChI | InChI=1S/C11H22N2O4S/c1-4-17-11(16)7(2)13-10(15)9(14)8(12)5-6-18-3/h7-9,14H,4-6,12H2,1-3H3,(H,13,15)/t7-,8+,9-/m0/s1 |
| InChIKey | JBCYFDUUKXUVHT-YIZRAAEISA-N |
| XLogP | -0.50 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-methylsulfanylpentanoyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-methylsulfanylpentanoyl]amino]propanoate?
The IUPAC name of ethyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-methylsulfanylpentanoyl]amino]propanoate (CID 23647751) is ethyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-methylsulfanylpentanoyl]amino]propanoate.
What is the SMILES notation for ethyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-methylsulfanylpentanoyl]amino]propanoate?
The canonical SMILES for ethyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-methylsulfanylpentanoyl]amino]propanoate is CCOC(=O)[C@H](C)NC(=O)[C@@H](O)[C@H](N)CCSC.
What is the InChIKey of ethyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-methylsulfanylpentanoyl]amino]propanoate?
The InChIKey is JBCYFDUUKXUVHT-YIZRAAEISA-N. The full InChI is InChI=1S/C11H22N2O4S/c1-4-17-11(16)7(2)13-10(15)9(14)8(12)5-6-18-3/h7-9,14H,4-6,12H2,1-3H3,(H,13,15)/t7-,8+,9-/m0/s1.
What are the key properties of ethyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-methylsulfanylpentanoyl]amino]propanoate?
ethyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-methylsulfanylpentanoyl]amino]propanoate has a molecular weight of 278.37 g/mol, XLogP of -0.50, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-5-methylsulfanylpentanoyl]amino]propanoate is sourced from PubChem (CID 23647751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).