C34H52N4O7 — CID 23647799
(2S)-2-[[2-[[3-[[(2S)-4-methyl-2-[[(E)-7-methyl-2-propan-2-yloct-4-enoyl]amino]pentanoyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetic acid (PubChem CID 23647799) has the molecular formula C34H52N4O7 and a molecular weight of 628.81 g/mol. Its IUPAC name is (2S)-2-[[2-[[3-[[(2S)-4-methyl-2-[[(E)-7-methyl-2-propan-2-yloct-4-enoyl]amino]pentanoyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[[2-[[3-[[(2S)-4-methyl-2-[[(E)-7-methyl-2-propan-2-yloct-4-enoyl]amino]pentanoyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 23647799 |
| Molecular Formula | C34H52N4O7 |
| Molecular Weight | 628.81 g/mol |
| Exact Mass | 628.38 |
| IUPAC Name | (2S)-2-[[2-[[3-[[(2S)-4-methyl-2-[[(E)-7-methyl-2-propan-2-yloct-4-enoyl]amino]pentanoyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetic acid |
| SMILES | CCCC(NC(=O)[C@H](CC(C)C)NC(=O)C(C/C=C/CC(C)C)C(C)C)C(=O)C(=O)NCC(=O)N[C@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C34H52N4O7/c1-8-14-26(30(40)33(43)35-20-28(39)38-29(34(44)45)24-16-10-9-11-17-24)36-32(42)27(19-22(4)5)37-31(41)25(23(6)7)18-13-12-15-21(2)3/h9-13,16-17,21-23,25-27,29H,8,14-15,18-20H2,1-7H3,(H,35,43)(H,36,42)(H,37,41)(H,38,39)(H,44,45)/b13-12+/t25?,26?,27-,29-/m0/s1 |
| InChIKey | KWTWSYDWITXSOY-HWJGHGKNSA-N |
| XLogP | 3.69 |
| TPSA | 170.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.81 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|