C26H44N4O6 — CID 23647802
tert-butyl N-[1-[(1R,5S)-2-[(1-amino-1,2-dioxoheptan-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 23647802) has the molecular formula C26H44N4O6 and a molecular weight of 508.66 g/mol. Its IUPAC name is tert-butyl N-[1-[(1R,5S)-2-[(1-amino-1,2-dioxoheptan-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(1R,5S)-2-[(1-amino-1,2-dioxoheptan-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 23647802 |
| Molecular Formula | C26H44N4O6 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.33 |
| IUPAC Name | tert-butyl N-[1-[(1R,5S)-2-[(1-amino-1,2-dioxoheptan-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCC(NC(=O)C1[C@@H]2[C@H](CN1C(=O)C(NC(=O)OC(C)(C)C)C(C)(C)C)C2(C)C)C(=O)C(N)=O |
| InChI | InChI=1S/C26H44N4O6/c1-10-11-12-15(18(31)20(27)32)28-21(33)17-16-14(26(16,8)9)13-30(17)22(34)19(24(2,3)4)29-23(35)36-25(5,6)7/h14-17,19H,10-13H2,1-9H3,(H2,27,32)(H,28,33)(H,29,35)/t14-,15?,16-,17?,19?/m0/s1 |
| InChIKey | FAPPNFHTSMEZSW-XAVVCJAESA-N |
| XLogP | 2.14 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|