C25H41N5O5 — CID 23647806
(1R,5S)-N-(3-amino-1-cyclopropyl-2,3-dioxopropyl)-3-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 23647806) has the molecular formula C25H41N5O5 and a molecular weight of 491.63 g/mol. Its IUPAC name is (1R,5S)-N-(3-amino-1-cyclopropyl-2,3-dioxopropyl)-3-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,5S)-N-(3-amino-1-cyclopropyl-2,3-dioxopropyl)-3-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 23647806 |
| Molecular Formula | C25H41N5O5 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | (1R,5S)-N-(3-amino-1-cyclopropyl-2,3-dioxopropyl)-3-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)NC(C(=O)N1C[C@H]2[C@@H](C1C(=O)NC(C(=O)C(N)=O)C1CC1)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C25H41N5O5/c1-23(2,3)18(28-22(35)29-24(4,5)6)21(34)30-11-13-14(25(13,7)8)16(30)20(33)27-15(12-9-10-12)17(31)19(26)32/h12-16,18H,9-11H2,1-8H3,(H2,26,32)(H,27,33)(H2,28,29,35)/t13-,14-,15?,16?,18?/m0/s1 |
| InChIKey | JPHRUHASJNNYHD-RSOWUBFDSA-N |
| XLogP | 0.93 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|