C26H43N5O5 — CID 23647807
(1R,5S)-N-(3-amino-1-cyclobutyl-2,3-dioxopropyl)-3-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 23647807) has the molecular formula C26H43N5O5 and a molecular weight of 505.66 g/mol. Its IUPAC name is (1R,5S)-N-(3-amino-1-cyclobutyl-2,3-dioxopropyl)-3-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,5S)-N-(3-amino-1-cyclobutyl-2,3-dioxopropyl)-3-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 23647807 |
| Molecular Formula | C26H43N5O5 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | (1R,5S)-N-(3-amino-1-cyclobutyl-2,3-dioxopropyl)-3-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)NC(C(=O)N1C[C@H]2[C@@H](C1C(=O)NC(C(=O)C(N)=O)C1CCC1)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H43N5O5/c1-24(2,3)19(29-23(36)30-25(4,5)6)22(35)31-12-14-15(26(14,7)8)17(31)21(34)28-16(13-10-9-11-13)18(32)20(27)33/h13-17,19H,9-12H2,1-8H3,(H2,27,33)(H,28,34)(H2,29,30,36)/t14-,15-,16?,17?,19?/m0/s1 |
| InChIKey | LIVZWBUJKWXSLM-XLWKGDHDSA-N |
| XLogP | 1.32 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|