C27H43F2N5O5 — CID 23647810
(1R,5S)-N-[4-amino-1-(3,3-difluorocyclobutyl)-3,4-dioxobutan-2-yl]-3-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 23647810) has the molecular formula C27H43F2N5O5 and a molecular weight of 555.67 g/mol. Its IUPAC name is (1R,5S)-N-[4-amino-1-(3,3-difluorocyclobutyl)-3,4-dioxobutan-2-yl]-3-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,5S)-N-[4-amino-1-(3,3-difluorocyclobutyl)-3,4-dioxobutan-2-yl]-3-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 23647810 |
| Molecular Formula | C27H43F2N5O5 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | (1R,5S)-N-[4-amino-1-(3,3-difluorocyclobutyl)-3,4-dioxobutan-2-yl]-3-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)NC(C(=O)N1C[C@H]2[C@@H](C1C(=O)NC(CC1CC(F)(F)C1)C(=O)C(N)=O)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C27H43F2N5O5/c1-24(2,3)19(32-23(39)33-25(4,5)6)22(38)34-12-14-16(26(14,7)8)17(34)21(37)31-15(18(35)20(30)36)9-13-10-27(28,29)11-13/h13-17,19H,9-12H2,1-8H3,(H2,30,36)(H,31,37)(H2,32,33,39)/t14-,15?,16-,17?,19?/m0/s1 |
| InChIKey | UEDMZRPUOVWABU-XAVVCJAESA-N |
| XLogP | 1.96 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|