C28H47N5O6 — CID 23647813
(3aR,6aR)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-5-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4-carboxamide (PubChem CID 23647813) has the molecular formula C28H47N5O6 and a molecular weight of 549.71 g/mol. Its IUPAC name is (3aR,6aR)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-5-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4-carboxamide.
| Compound Name | (3aR,6aR)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-5-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 23647813 |
| Molecular Formula | C28H47N5O6 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.35 |
| IUPAC Name | (3aR,6aR)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-5-[2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)NC(C(=O)N1C[C@@H]2OC(C)(C)C[C@@H]2C1C(=O)NC(CC1CCC1)C(=O)C(N)=O)C(C)(C)C |
| InChI | InChI=1S/C28H47N5O6/c1-26(2,3)21(31-25(38)32-27(4,5)6)24(37)33-14-18-16(13-28(7,8)39-18)19(33)23(36)30-17(20(34)22(29)35)12-15-10-9-11-15/h15-19,21H,9-14H2,1-8H3,(H2,29,35)(H,30,36)(H2,31,32,38)/t16-,17?,18-,19?,21?/m0/s1 |
| InChIKey | VPHHRKBHKCXJIE-MHBFLPFYSA-N |
| XLogP | 1.62 |
| TPSA | 159.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|