C25H41N3O3 — CID 23647855
(2R,4S,5S)-5-amino-N-butyl-9-(3,4-dihydro-2H-quinolin-1-yl)-4-hydroxy-2,7,7-trimethyl-9-oxononanamide (PubChem CID 23647855) has the molecular formula C25H41N3O3 and a molecular weight of 431.62 g/mol. Its IUPAC name is (2R,4S,5S)-5-amino-N-butyl-9-(3,4-dihydro-2H-quinolin-1-yl)-4-hydroxy-2,7,7-trimethyl-9-oxononanamide.
| Compound Name | (2R,4S,5S)-5-amino-N-butyl-9-(3,4-dihydro-2H-quinolin-1-yl)-4-hydroxy-2,7,7-trimethyl-9-oxononanamide |
|---|---|
| PubChem CID | 23647855 |
| Molecular Formula | C25H41N3O3 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.31 |
| IUPAC Name | (2R,4S,5S)-5-amino-N-butyl-9-(3,4-dihydro-2H-quinolin-1-yl)-4-hydroxy-2,7,7-trimethyl-9-oxononanamide |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H](N)CC(C)(C)CC(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C25H41N3O3/c1-5-6-13-27-24(31)18(2)15-22(29)20(26)16-25(3,4)17-23(30)28-14-9-11-19-10-7-8-12-21(19)28/h7-8,10,12,18,20,22,29H,5-6,9,11,13-17,26H2,1-4H3,(H,27,31)/t18-,20+,22+/m1/s1 |
| InChIKey | BVJOWZFWZASPEA-CBQOVEMMSA-N |
| XLogP | 3.40 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|