C32H41N3O3 — CID 23647859
(3S,4R)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-N-(1,2,3,4-tetrahydroquinolin-7-ylmethyl)piperidin-3-amine (PubChem CID 23647859) has the molecular formula C32H41N3O3 and a molecular weight of 515.70 g/mol. Its IUPAC name is (3S,4R)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-N-(1,2,3,4-tetrahydroquinolin-7-ylmethyl)piperidin-3-amine.
| Compound Name | (3S,4R)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-N-(1,2,3,4-tetrahydroquinolin-7-ylmethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 23647859 |
| Molecular Formula | C32H41N3O3 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | (3S,4R)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-N-(1,2,3,4-tetrahydroquinolin-7-ylmethyl)piperidin-3-amine |
| SMILES | COc1ccccc1COCCCOc1ccc([C@H]2CCNC[C@H]2NCc2ccc3c(c2)NCCC3)cc1 |
| InChI | InChI=1S/C32H41N3O3/c1-36-32-8-3-2-6-27(32)23-37-18-5-19-38-28-13-11-25(12-14-28)29-15-17-33-22-31(29)35-21-24-9-10-26-7-4-16-34-30(26)20-24/h2-3,6,8-14,20,29,31,33-35H,4-5,7,15-19,21-23H2,1H3/t29-,31-/m1/s1 |
| InChIKey | KKXYEMLRFDXQTG-BVRKHOPBSA-N |
| XLogP | 5.27 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|