C31H37N3O3 — CID 23647862
(3S,4R)-N-(1H-indol-5-ylmethyl)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-amine (PubChem CID 23647862) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is (3S,4R)-N-(1H-indol-5-ylmethyl)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-amine.
| Compound Name | (3S,4R)-N-(1H-indol-5-ylmethyl)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-amine |
|---|---|
| PubChem CID | 23647862 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | (3S,4R)-N-(1H-indol-5-ylmethyl)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-amine |
| SMILES | COc1ccccc1COCCCOc1ccc([C@H]2CCNC[C@H]2NCc2ccc3[nH]ccc3c2)cc1 |
| InChI | InChI=1S/C31H37N3O3/c1-35-31-6-3-2-5-26(31)22-36-17-4-18-37-27-10-8-24(9-11-27)28-14-15-32-21-30(28)34-20-23-7-12-29-25(19-23)13-16-33-29/h2-3,5-13,16,19,28,30,32-34H,4,14-15,17-18,20-22H2,1H3/t28-,30-/m1/s1 |
| InChIKey | UHZVNQHANFABIP-PQHLKRTFSA-N |
| XLogP | 5.40 |
| TPSA | 67.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|