C32H40N2O4 — CID 23647868
(2R)-1-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)piperazine (PubChem CID 23647868) has the molecular formula C32H40N2O4 and a molecular weight of 516.68 g/mol. Its IUPAC name is (2R)-1-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)piperazine.
| Compound Name | (2R)-1-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)piperazine |
|---|---|
| PubChem CID | 23647868 |
| Molecular Formula | C32H40N2O4 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | (2R)-1-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)piperazine |
| SMILES | COc1ccccc1COCCCOc1ccc(N2CCNC[C@@H]2COc2ccc3c(c2)CCCC3)cc1 |
| InChI | InChI=1S/C32H40N2O4/c1-35-32-10-5-4-9-27(32)23-36-19-6-20-37-30-15-12-28(13-16-30)34-18-17-33-22-29(34)24-38-31-14-11-25-7-2-3-8-26(25)21-31/h4-5,9-16,21,29,33H,2-3,6-8,17-20,22-24H2,1H3/t29-/m1/s1 |
| InChIKey | UMWUHBWCBWENIX-GDLZYMKVSA-N |
| XLogP | 5.42 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|