C19H27N5O2 — CID 23647872
6-ethyl-5-[(2R)-4-(3-methoxypropyl)-2-methyl-2,3-dihydro-1,4-benzoxazin-6-yl]pyrimidine-2,4-diamine (PubChem CID 23647872) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 6-ethyl-5-[(2R)-4-(3-methoxypropyl)-2-methyl-2,3-dihydro-1,4-benzoxazin-6-yl]pyrimidine-2,4-diamine.
| Compound Name | 6-ethyl-5-[(2R)-4-(3-methoxypropyl)-2-methyl-2,3-dihydro-1,4-benzoxazin-6-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 23647872 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 6-ethyl-5-[(2R)-4-(3-methoxypropyl)-2-methyl-2,3-dihydro-1,4-benzoxazin-6-yl]pyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc2c(c1)N(CCCOC)C[C@@H](C)O2 |
| InChI | InChI=1S/C19H27N5O2/c1-4-14-17(18(20)23-19(21)22-14)13-6-7-16-15(10-13)24(8-5-9-25-3)11-12(2)26-16/h6-7,10,12H,4-5,8-9,11H2,1-3H3,(H4,20,21,22,23)/t12-/m1/s1 |
| InChIKey | JXDVAXZXKPBBKM-GFCCVEGCSA-N |
| XLogP | 2.49 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|