C24H27N5O3 — CID 23647878
6-(2,4-diamino-6-ethylpyrimidin-5-yl)-4-(3-methoxypropyl)-2-phenyl-1,4-benzoxazin-3-one (PubChem CID 23647878) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is 6-(2,4-diamino-6-ethylpyrimidin-5-yl)-4-(3-methoxypropyl)-2-phenyl-1,4-benzoxazin-3-one.
| Compound Name | 6-(2,4-diamino-6-ethylpyrimidin-5-yl)-4-(3-methoxypropyl)-2-phenyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23647878 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 6-(2,4-diamino-6-ethylpyrimidin-5-yl)-4-(3-methoxypropyl)-2-phenyl-1,4-benzoxazin-3-one |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc2c(c1)N(CCCOC)C(=O)C(c1ccccc1)O2 |
| InChI | InChI=1S/C24H27N5O3/c1-3-17-20(22(25)28-24(26)27-17)16-10-11-19-18(14-16)29(12-7-13-31-2)23(30)21(32-19)15-8-5-4-6-9-15/h4-6,8-11,14,21H,3,7,12-13H2,1-2H3,(H4,25,26,27,28) |
| InChIKey | BBUAFKOJRUKNLF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|