C22H31N5O3 — CID 23647884
6-(2,4-diamino-6-ethylpyrimidin-5-yl)-2,2-diethyl-4-(3-methoxypropyl)-1,4-benzoxazin-3-one (PubChem CID 23647884) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 6-(2,4-diamino-6-ethylpyrimidin-5-yl)-2,2-diethyl-4-(3-methoxypropyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-(2,4-diamino-6-ethylpyrimidin-5-yl)-2,2-diethyl-4-(3-methoxypropyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23647884 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 6-(2,4-diamino-6-ethylpyrimidin-5-yl)-2,2-diethyl-4-(3-methoxypropyl)-1,4-benzoxazin-3-one |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc2c(c1)N(CCCOC)C(=O)C(CC)(CC)O2 |
| InChI | InChI=1S/C22H31N5O3/c1-5-15-18(19(23)26-21(24)25-15)14-9-10-17-16(13-14)27(11-8-12-29-4)20(28)22(6-2,7-3)30-17/h9-10,13H,5-8,11-12H2,1-4H3,(H4,23,24,25,26) |
| InChIKey | QENBZBQERGRPHC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|