C12H25NO4 — CID 23647981
(2R,3S,4R,5R,6R)-2-hexyl-6-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 23647981) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-2-hexyl-6-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6R)-2-hexyl-6-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 23647981 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | (2R,3S,4R,5R,6R)-2-hexyl-6-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | CCCCCC[C@H]1N[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H25NO4/c1-2-3-4-5-6-8-10(15)12(17)11(16)9(7-14)13-8/h8-17H,2-7H2,1H3/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | CNCWFVJLRHKDJX-RMPHRYRLSA-N |
| XLogP | -0.63 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|