C16H24N6O2 — CID 23648013
2-[[4-(butylamino)-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 23648013) has the molecular formula C16H24N6O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-[[4-(butylamino)-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-(butylamino)-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 23648013 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-[[4-(butylamino)-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | CCCCNc1nc(NCCO)nc(Nc2ccccc2OC)n1 |
| InChI | InChI=1S/C16H24N6O2/c1-3-4-9-17-14-20-15(18-10-11-23)22-16(21-14)19-12-7-5-6-8-13(12)24-2/h5-8,23H,3-4,9-11H2,1-2H3,(H3,17,18,19,20,21,22) |
| InChIKey | DWTQAMUCUCTLIA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|