C21H24N6O2 — CID 23648035
2-[[4-(2-hydroxyethylamino)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]amino]-4-phenylphenol (PubChem CID 23648035) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-[[4-(2-hydroxyethylamino)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]amino]-4-phenylphenol.
| Compound Name | 2-[[4-(2-hydroxyethylamino)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]amino]-4-phenylphenol |
|---|---|
| PubChem CID | 23648035 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 2-[[4-(2-hydroxyethylamino)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]amino]-4-phenylphenol |
| SMILES | OCCNc1nc(Nc2cc(-c3ccccc3)ccc2O)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C21H24N6O2/c28-13-10-22-19-24-20(26-21(25-19)27-11-4-5-12-27)23-17-14-16(8-9-18(17)29)15-6-2-1-3-7-15/h1-3,6-9,14,28-29H,4-5,10-13H2,(H2,22,23,24,25,26) |
| InChIKey | FEQNEXSELHWMTI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|