About naphtho[1,2-g]quinazoline-9,11-diamine
naphtho[1,2-g]quinazoline-9,11-diamine (PubChem CID 23648040) has the molecular formula C16H12N4
and a molecular weight of 260.30 g/mol. Its IUPAC name is naphtho[1,2-g]quinazoline-9,11-diamine.
Molecular Properties
| Compound Name | naphtho[1,2-g]quinazoline-9,11-diamine |
| PubChem CID | 23648040 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | naphtho[1,2-g]quinazoline-9,11-diamine |
| SMILES | Nc1nc(N)c2cc3c(ccc4ccccc43)cc2n1 |
| InChI | InChI=1S/C16H12N4/c17-15-13-8-12-10(7-14(13)19-16(18)20-15)6-5-9-3-1-2-4-11(9)12/h1-8H,(H4,17,18,19,20) |
| InChIKey | KLHFKOIXEQVMKJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze naphtho[1,2-g]quinazoline-9,11-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphtho[1,2-g]quinazoline-9,11-diamine?
The IUPAC name of naphtho[1,2-g]quinazoline-9,11-diamine (CID 23648040) is naphtho[1,2-g]quinazoline-9,11-diamine.
What is the SMILES notation for naphtho[1,2-g]quinazoline-9,11-diamine?
The canonical SMILES for naphtho[1,2-g]quinazoline-9,11-diamine is Nc1nc(N)c2cc3c(ccc4ccccc43)cc2n1.
What is the InChIKey of naphtho[1,2-g]quinazoline-9,11-diamine?
The InChIKey is KLHFKOIXEQVMKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4/c17-15-13-8-12-10(7-14(13)19-16(18)20-15)6-5-9-3-1-2-4-11(9)12/h1-8H,(H4,17,18,19,20).
What are the key properties of naphtho[1,2-g]quinazoline-9,11-diamine?
naphtho[1,2-g]quinazoline-9,11-diamine has a molecular weight of 260.30 g/mol, XLogP of 3.10, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphtho[1,2-g]quinazoline-9,11-diamine is sourced from PubChem (CID 23648040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).