About 6-[bis(2,2,2-trifluoroethyl)amino]-4-chloro-1H-quinolin-2-one
6-[bis(2,2,2-trifluoroethyl)amino]-4-chloro-1H-quinolin-2-one (PubChem CID 23648062) has the molecular formula C13H9ClF6N2O
and a molecular weight of 358.67 g/mol. Its IUPAC name is 6-[bis(2,2,2-trifluoroethyl)amino]-4-chloro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 6-[bis(2,2,2-trifluoroethyl)amino]-4-chloro-1H-quinolin-2-one |
| PubChem CID | 23648062 |
| Molecular Formula | C13H9ClF6N2O |
| Molecular Weight | 358.67 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 6-[bis(2,2,2-trifluoroethyl)amino]-4-chloro-1H-quinolin-2-one |
| SMILES | O=c1cc(Cl)c2cc(N(CC(F)(F)F)CC(F)(F)F)ccc2[nH]1 |
| InChI | InChI=1S/C13H9ClF6N2O/c14-9-4-11(23)21-10-2-1-7(3-8(9)10)22(5-12(15,16)17)6-13(18,19)20/h1-4H,5-6H2,(H,21,23) |
| InChIKey | DHGDSKLRFDOJEF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.67 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[bis(2,2,2-trifluoroethyl)amino]-4-chloro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[bis(2,2,2-trifluoroethyl)amino]-4-chloro-1H-quinolin-2-one?
The IUPAC name of 6-[bis(2,2,2-trifluoroethyl)amino]-4-chloro-1H-quinolin-2-one (CID 23648062) is 6-[bis(2,2,2-trifluoroethyl)amino]-4-chloro-1H-quinolin-2-one.
What is the SMILES notation for 6-[bis(2,2,2-trifluoroethyl)amino]-4-chloro-1H-quinolin-2-one?
The canonical SMILES for 6-[bis(2,2,2-trifluoroethyl)amino]-4-chloro-1H-quinolin-2-one is O=c1cc(Cl)c2cc(N(CC(F)(F)F)CC(F)(F)F)ccc2[nH]1.
What is the InChIKey of 6-[bis(2,2,2-trifluoroethyl)amino]-4-chloro-1H-quinolin-2-one?
The InChIKey is DHGDSKLRFDOJEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClF6N2O/c14-9-4-11(23)21-10-2-1-7(3-8(9)10)22(5-12(15,16)17)6-13(18,19)20/h1-4H,5-6H2,(H,21,23).
What are the key properties of 6-[bis(2,2,2-trifluoroethyl)amino]-4-chloro-1H-quinolin-2-one?
6-[bis(2,2,2-trifluoroethyl)amino]-4-chloro-1H-quinolin-2-one has a molecular weight of 358.67 g/mol, XLogP of 4.11, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[bis(2,2,2-trifluoroethyl)amino]-4-chloro-1H-quinolin-2-one is sourced from PubChem (CID 23648062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).