C25H23Br2NO5 — CID 23648133
2-[3,5-dibromo-4-[4-hydroxy-3-(4-phenylbutylcarbamoyl)phenoxy]phenyl]acetic acid (PubChem CID 23648133) has the molecular formula C25H23Br2NO5 and a molecular weight of 577.27 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[4-hydroxy-3-(4-phenylbutylcarbamoyl)phenoxy]phenyl]acetic acid.
| Compound Name | 2-[3,5-dibromo-4-[4-hydroxy-3-(4-phenylbutylcarbamoyl)phenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 23648133 |
| Molecular Formula | C25H23Br2NO5 |
| Molecular Weight | 577.27 g/mol |
| Exact Mass | 574.99 |
| IUPAC Name | 2-[3,5-dibromo-4-[4-hydroxy-3-(4-phenylbutylcarbamoyl)phenoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(Br)c(Oc2ccc(O)c(C(=O)NCCCCc3ccccc3)c2)c(Br)c1 |
| InChI | InChI=1S/C25H23Br2NO5/c26-20-12-17(14-23(30)31)13-21(27)24(20)33-18-9-10-22(29)19(15-18)25(32)28-11-5-4-8-16-6-2-1-3-7-16/h1-3,6-7,9-10,12-13,15,29H,4-5,8,11,14H2,(H,28,32)(H,30,31) |
| InChIKey | IIYKWHVHNIUBER-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.27 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|