C24H28N6O2 — CID 23648179
2-methoxy-9-methyl-3-N-(2-morpholin-4-ylethyl)quinolino[3,4-c]quinoline-3,7,10-triamine (PubChem CID 23648179) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 2-methoxy-9-methyl-3-N-(2-morpholin-4-ylethyl)quinolino[3,4-c]quinoline-3,7,10-triamine.
| Compound Name | 2-methoxy-9-methyl-3-N-(2-morpholin-4-ylethyl)quinolino[3,4-c]quinoline-3,7,10-triamine |
|---|---|
| PubChem CID | 23648179 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 2-methoxy-9-methyl-3-N-(2-morpholin-4-ylethyl)quinolino[3,4-c]quinoline-3,7,10-triamine |
| SMILES | COc1cc2c(cc1NCCN1CCOCC1)ncc1c(N)nc3c(C)c(N)ccc3c12 |
| InChI | InChI=1S/C24H28N6O2/c1-14-18(25)4-3-15-22-16-11-21(31-2)20(27-5-6-30-7-9-32-10-8-30)12-19(16)28-13-17(22)24(26)29-23(14)15/h3-4,11-13,27H,5-10,25H2,1-2H3,(H2,26,29) |
| InChIKey | JCGJWSWZWHUJDT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|