C25H30N6O2 — CID 23648180
2-methoxy-9-methyl-3-N-(3-morpholin-4-ylpropyl)quinolino[3,4-c]quinoline-3,7,10-triamine (PubChem CID 23648180) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is 2-methoxy-9-methyl-3-N-(3-morpholin-4-ylpropyl)quinolino[3,4-c]quinoline-3,7,10-triamine.
| Compound Name | 2-methoxy-9-methyl-3-N-(3-morpholin-4-ylpropyl)quinolino[3,4-c]quinoline-3,7,10-triamine |
|---|---|
| PubChem CID | 23648180 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 2-methoxy-9-methyl-3-N-(3-morpholin-4-ylpropyl)quinolino[3,4-c]quinoline-3,7,10-triamine |
| SMILES | COc1cc2c(cc1NCCCN1CCOCC1)ncc1c(N)nc3c(C)c(N)ccc3c12 |
| InChI | InChI=1S/C25H30N6O2/c1-15-19(26)5-4-16-23-17-12-22(32-2)21(28-6-3-7-31-8-10-33-11-9-31)13-20(17)29-14-18(23)25(27)30-24(15)16/h4-5,12-14,28H,3,6-11,26H2,1-2H3,(H2,27,30) |
| InChIKey | PICVLQXQBLBFNU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|