C23H28N6O — CID 23648181
3-N-[3-(dimethylamino)propyl]-2-methoxy-9-methylquinolino[3,4-c]quinoline-3,7,10-triamine (PubChem CID 23648181) has the molecular formula C23H28N6O and a molecular weight of 404.52 g/mol. Its IUPAC name is 3-N-[3-(dimethylamino)propyl]-2-methoxy-9-methylquinolino[3,4-c]quinoline-3,7,10-triamine.
| Compound Name | 3-N-[3-(dimethylamino)propyl]-2-methoxy-9-methylquinolino[3,4-c]quinoline-3,7,10-triamine |
|---|---|
| PubChem CID | 23648181 |
| Molecular Formula | C23H28N6O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 3-N-[3-(dimethylamino)propyl]-2-methoxy-9-methylquinolino[3,4-c]quinoline-3,7,10-triamine |
| SMILES | COc1cc2c(cc1NCCCN(C)C)ncc1c(N)nc3c(C)c(N)ccc3c12 |
| InChI | InChI=1S/C23H28N6O/c1-13-17(24)7-6-14-21-15-10-20(30-4)19(26-8-5-9-29(2)3)11-18(15)27-12-16(21)23(25)28-22(13)14/h6-7,10-12,26H,5,8-9,24H2,1-4H3,(H2,25,28) |
| InChIKey | PVFHCQGAYHDIOF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|