C30H50N2O3 — CID 23648184
(3R,6R,7S,8R,10S,11R,14R,15S,18S,20S)-7-[(1S)-1-(dimethylamino)ethyl]-8-hydroxy-6,10,15-trimethyl-18-propan-2-yl-17-oxa-19-azapentacyclo[12.8.0.03,11.06,10.015,20]docos-1(22)-en-4-one (PubChem CID 23648184) has the molecular formula C30H50N2O3 and a molecular weight of 486.74 g/mol. Its IUPAC name is (3R,6R,7S,8R,10S,11R,14R,15S,18S,20S)-7-[(1S)-1-(dimethylamino)ethyl]-8-hydroxy-6,10,15-trimethyl-18-propan-2-yl-17-oxa-19-azapentacyclo[12.8.0.03,11.06,10.015,20]docos-1(22)-en-4-one.
| Compound Name | (3R,6R,7S,8R,10S,11R,14R,15S,18S,20S)-7-[(1S)-1-(dimethylamino)ethyl]-8-hydroxy-6,10,15-trimethyl-18-propan-2-yl-17-oxa-19-azapentacyclo[12.8.0.03,11.06,10.015,20]docos-1(22)-en-4-one |
|---|---|
| PubChem CID | 23648184 |
| Molecular Formula | C30H50N2O3 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.38 |
| IUPAC Name | (3R,6R,7S,8R,10S,11R,14R,15S,18S,20S)-7-[(1S)-1-(dimethylamino)ethyl]-8-hydroxy-6,10,15-trimethyl-18-propan-2-yl-17-oxa-19-azapentacyclo[12.8.0.03,11.06,10.015,20]docos-1(22)-en-4-one |
| SMILES | CC(C)[C@H]1N[C@H]2CC=C3C[C@H]4C(=O)C[C@]5(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@@]5(C)[C@@H]4CC[C@H]3[C@]2(C)CO1 |
| InChI | InChI=1S/C30H50N2O3/c1-17(2)27-31-25-12-9-19-13-20-22(11-10-21(19)28(25,4)16-35-27)29(5)15-24(34)26(18(3)32(7)8)30(29,6)14-23(20)33/h9,17-18,20-22,24-27,31,34H,10-16H2,1-8H3/t18-,20+,21+,22+,24+,25-,26-,27-,28-,29-,30+/m0/s1 |
| InChIKey | JBPGYRHBMNBNDV-LAFPDDBPSA-N |
| XLogP | 4.64 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|