C27H37BrN4O5 — CID 23648190
(3S,9S,12R)-3-benzyl-9-(7-bromo-6-oxoheptyl)-6,6-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 23648190) has the molecular formula C27H37BrN4O5 and a molecular weight of 577.52 g/mol. Its IUPAC name is (3S,9S,12R)-3-benzyl-9-(7-bromo-6-oxoheptyl)-6,6-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,9S,12R)-3-benzyl-9-(7-bromo-6-oxoheptyl)-6,6-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 23648190 |
| Molecular Formula | C27H37BrN4O5 |
| Molecular Weight | 577.52 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | (3S,9S,12R)-3-benzyl-9-(7-bromo-6-oxoheptyl)-6,6-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CC1(C)NC(=O)[C@H](CCCCCC(=O)CBr)NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C27H37BrN4O5/c1-27(2)26(37)30-21(16-18-10-5-3-6-11-18)25(36)32-15-9-14-22(32)24(35)29-20(23(34)31-27)13-8-4-7-12-19(33)17-28/h3,5-6,10-11,20-22H,4,7-9,12-17H2,1-2H3,(H,29,35)(H,30,37)(H,31,34)/t20-,21-,22+/m0/s1 |
| InChIKey | JVGKFKCLINQLIO-FDFHNCONSA-N |
| XLogP | 2.01 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|