C14H24F3N3O — CID 23648298
(2S)-N-(cyanomethyl)-4-methyl-2-[[(2S)-1,1,1-trifluorohexan-2-yl]amino]pentanamide (PubChem CID 23648298) has the molecular formula C14H24F3N3O and a molecular weight of 307.36 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-4-methyl-2-[[(2S)-1,1,1-trifluorohexan-2-yl]amino]pentanamide.
| Compound Name | (2S)-N-(cyanomethyl)-4-methyl-2-[[(2S)-1,1,1-trifluorohexan-2-yl]amino]pentanamide |
|---|---|
| PubChem CID | 23648298 |
| Molecular Formula | C14H24F3N3O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (2S)-N-(cyanomethyl)-4-methyl-2-[[(2S)-1,1,1-trifluorohexan-2-yl]amino]pentanamide |
| SMILES | CCCC[C@H](N[C@@H](CC(C)C)C(=O)NCC#N)C(F)(F)F |
| InChI | InChI=1S/C14H24F3N3O/c1-4-5-6-12(14(15,16)17)20-11(9-10(2)3)13(21)19-8-7-18/h10-12,20H,4-6,8-9H2,1-3H3,(H,19,21)/t11-,12-/m0/s1 |
| InChIKey | VJBHFNIJBKVCJM-RYUDHWBXSA-N |
| XLogP | 2.75 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|