C25H33N3O3 — CID 23648312
N-[(1S)-1-cyclohexyl-2-[2-(4-methoxyanilino)ethylamino]-2-oxoethyl]-3-methylbenzamide (PubChem CID 23648312) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is N-[(1S)-1-cyclohexyl-2-[2-(4-methoxyanilino)ethylamino]-2-oxoethyl]-3-methylbenzamide.
| Compound Name | N-[(1S)-1-cyclohexyl-2-[2-(4-methoxyanilino)ethylamino]-2-oxoethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 23648312 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | N-[(1S)-1-cyclohexyl-2-[2-(4-methoxyanilino)ethylamino]-2-oxoethyl]-3-methylbenzamide |
| SMILES | COc1ccc(NCCNC(=O)[C@@H](NC(=O)c2cccc(C)c2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H33N3O3/c1-18-7-6-10-20(17-18)24(29)28-23(19-8-4-3-5-9-19)25(30)27-16-15-26-21-11-13-22(31-2)14-12-21/h6-7,10-14,17,19,23,26H,3-5,8-9,15-16H2,1-2H3,(H,27,30)(H,28,29)/t23-/m0/s1 |
| InChIKey | VEUMPOBSVCGSCK-QHCPKHFHSA-N |
| XLogP | 3.91 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|