C23H26N4O3S — CID 23648327
N-[(2S)-1-[2-(4-methoxyanilino)ethylamino]-1-oxo-3-(1,3-thiazol-5-yl)propan-2-yl]-3-methylbenzamide (PubChem CID 23648327) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[(2S)-1-[2-(4-methoxyanilino)ethylamino]-1-oxo-3-(1,3-thiazol-5-yl)propan-2-yl]-3-methylbenzamide.
| Compound Name | N-[(2S)-1-[2-(4-methoxyanilino)ethylamino]-1-oxo-3-(1,3-thiazol-5-yl)propan-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 23648327 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-[(2S)-1-[2-(4-methoxyanilino)ethylamino]-1-oxo-3-(1,3-thiazol-5-yl)propan-2-yl]-3-methylbenzamide |
| SMILES | COc1ccc(NCCNC(=O)[C@H](Cc2cncs2)NC(=O)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C23H26N4O3S/c1-16-4-3-5-17(12-16)22(28)27-21(13-20-14-24-15-31-20)23(29)26-11-10-25-18-6-8-19(30-2)9-7-18/h3-9,12,14-15,21,25H,10-11,13H2,1-2H3,(H,26,29)(H,27,28)/t21-/m0/s1 |
| InChIKey | WCIOVUCILURSAQ-NRFANRHFSA-N |
| XLogP | 3.03 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|