C26H24F5N3O3 — CID 23648331
N-[(2S)-1-[2-(4-methoxyanilino)ethylamino]-1-oxo-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]-3-methylbenzamide (PubChem CID 23648331) has the molecular formula C26H24F5N3O3 and a molecular weight of 521.49 g/mol. Its IUPAC name is N-[(2S)-1-[2-(4-methoxyanilino)ethylamino]-1-oxo-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]-3-methylbenzamide.
| Compound Name | N-[(2S)-1-[2-(4-methoxyanilino)ethylamino]-1-oxo-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 23648331 |
| Molecular Formula | C26H24F5N3O3 |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | N-[(2S)-1-[2-(4-methoxyanilino)ethylamino]-1-oxo-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]-3-methylbenzamide |
| SMILES | COc1ccc(NCCNC(=O)[C@H](Cc2c(F)c(F)c(F)c(F)c2F)NC(=O)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C26H24F5N3O3/c1-14-4-3-5-15(12-14)25(35)34-19(13-18-20(27)22(29)24(31)23(30)21(18)28)26(36)33-11-10-32-16-6-8-17(37-2)9-7-16/h3-9,12,19,32H,10-11,13H2,1-2H3,(H,33,36)(H,34,35)/t19-/m0/s1 |
| InChIKey | XSNHMLRAMNDWFZ-IBGZPJMESA-N |
| XLogP | 4.27 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|