C27H34N6O3 — CID 23648339
N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 23648339) has the molecular formula C27H34N6O3 and a molecular weight of 490.61 g/mol. Its IUPAC name is N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 23648339 |
| Molecular Formula | C27H34N6O3 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | COc1ccc(NCCNC(=O)[C@H](CC2CCCCC2)NC(=O)c2ccc(-n3cncn3)cc2)cc1 |
| InChI | InChI=1S/C27H34N6O3/c1-36-24-13-9-22(10-14-24)29-15-16-30-27(35)25(17-20-5-3-2-4-6-20)32-26(34)21-7-11-23(12-8-21)33-19-28-18-31-33/h7-14,18-20,25,29H,2-6,15-17H2,1H3,(H,30,35)(H,32,34)/t25-/m0/s1 |
| InChIKey | KOLZVLRWUSMIPM-VWLOTQADSA-N |
| XLogP | 3.57 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|