C31H40N6O3 — CID 23648340
N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-4-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide (PubChem CID 23648340) has the molecular formula C31H40N6O3 and a molecular weight of 544.70 g/mol. Its IUPAC name is N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-4-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide.
| Compound Name | N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-4-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 23648340 |
| Molecular Formula | C31H40N6O3 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-4-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide |
| SMILES | COc1ccc(NCCNC(=O)[C@H](CC2CCCCC2)NC(=O)c2ccc(Nc3nc(C)cc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C31H40N6O3/c1-21-19-22(2)35-31(34-21)36-26-11-9-24(10-12-26)29(38)37-28(20-23-7-5-4-6-8-23)30(39)33-18-17-32-25-13-15-27(40-3)16-14-25/h9-16,19,23,28,32H,4-8,17-18,20H2,1-3H3,(H,33,39)(H,37,38)(H,34,35,36)/t28-/m0/s1 |
| InChIKey | PRGVGZFPDSRIPJ-NDEPHWFRSA-N |
| XLogP | 5.14 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|