C29H37N5O3 — CID 23648343
N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-5-methyl-1-phenylpyrazole-4-carboxamide (PubChem CID 23648343) has the molecular formula C29H37N5O3 and a molecular weight of 503.65 g/mol. Its IUPAC name is N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-5-methyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-5-methyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 23648343 |
| Molecular Formula | C29H37N5O3 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-5-methyl-1-phenylpyrazole-4-carboxamide |
| SMILES | COc1ccc(NCCNC(=O)[C@H](CC2CCCCC2)NC(=O)c2cnn(-c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C29H37N5O3/c1-21-26(20-32-34(21)24-11-7-4-8-12-24)28(35)33-27(19-22-9-5-3-6-10-22)29(36)31-18-17-30-23-13-15-25(37-2)16-14-23/h4,7-8,11-16,20,22,27,30H,3,5-6,9-10,17-19H2,1-2H3,(H,31,36)(H,33,35)/t27-/m0/s1 |
| InChIKey | SOLUSPIOJGWVKG-MHZLTWQESA-N |
| XLogP | 4.49 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|