C26H21F3N2O2 — CID 23648467
2-[4-[[3-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]acetic acid (PubChem CID 23648467) has the molecular formula C26H21F3N2O2 and a molecular weight of 450.46 g/mol. Its IUPAC name is 2-[4-[[3-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[3-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 23648467 |
| Molecular Formula | C26H21F3N2O2 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-[4-[[3-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]acetic acid |
| SMILES | Cc1cnc2c(C(F)(F)F)cccc2c1-c1cccc(NCc2ccc(CC(=O)O)cc2)c1 |
| InChI | InChI=1S/C26H21F3N2O2/c1-16-14-31-25-21(6-3-7-22(25)26(27,28)29)24(16)19-4-2-5-20(13-19)30-15-18-10-8-17(9-11-18)12-23(32)33/h2-11,13-14,30H,12,15H2,1H3,(H,32,33) |
| InChIKey | OEDBWXLEGYGITE-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |