C13H23N3O3 — CID 23648531
tert-butyl N-[(1S,2R)-1-[(cyanomethyl)carbamoyl]-2-methylbutyl]carbamate (PubChem CID 23648531) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-1-(cyanomethylamino)-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R)-1-[(cyanomethyl)carbamoyl]-2-methylbutyl]carbamate |
|---|---|
| PubChem CID | 23648531 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | tert-butyl N-[(2S,3R)-1-(cyanomethylamino)-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC[C@@H](C)[C@@H](C(=O)NCC#N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23N3O3/c1-6-9(2)10(11(17)15-8-7-14)16-12(18)19-13(3,4)5/h9-10H,6,8H2,1-5H3,(H,15,17)(H,16,18)/t9-,10+/m1/s1 |
| InChIKey | HNTBSHVGXMFKKB-ZJUUUORDSA-N |
| XLogP | 1.30 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | 365 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|