C18H19N3O4S2 — CID 23648953
N-(1,1-dioxothian-4-yl)-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide (PubChem CID 23648953) has the molecular formula C18H19N3O4S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 23648953 |
| Molecular Formula | C18H19N3O4S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide |
| SMILES | O=S1(=O)CCC(NS(=O)(=O)c2ccc(-c3ccnc4[nH]ccc34)cc2)CC1 |
| InChI | InChI=1S/C18H19N3O4S2/c22-26(23)11-7-14(8-12-26)21-27(24,25)15-3-1-13(2-4-15)16-5-9-19-18-17(16)6-10-20-18/h1-6,9-10,14,21H,7-8,11-12H2,(H,19,20) |
| InChIKey | DKWGAYFHMCUJEN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |