About [2-[methyl(4-phenylbutyl)amino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate
[2-[methyl(4-phenylbutyl)amino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 23648974) has the molecular formula C28H33NO3S2
and a molecular weight of 495.71 g/mol. Its IUPAC name is [2-[methyl(4-phenylbutyl)amino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
Molecular Properties
| Compound Name | [2-[methyl(4-phenylbutyl)amino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| PubChem CID | 23648974 |
| Molecular Formula | C28H33NO3S2 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | [2-[methyl(4-phenylbutyl)amino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | CN(CCCCc1ccccc1)C1CC2CCC1C2OC(=O)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C28H33NO3S2/c1-29(16-6-5-11-20-9-3-2-4-10-20)23-19-21-14-15-22(23)26(21)32-27(30)28(31,24-12-7-17-33-24)25-13-8-18-34-25/h2-4,7-10,12-13,17-18,21-23,26,31H,5-6,11,14-16,19H2,1H3 |
| InChIKey | WCWYNAZLWINHSG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-[methyl(4-phenylbutyl)amino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[methyl(4-phenylbutyl)amino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate?
The IUPAC name of [2-[methyl(4-phenylbutyl)amino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate (CID 23648974) is [2-[methyl(4-phenylbutyl)amino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
What is the SMILES notation for [2-[methyl(4-phenylbutyl)amino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate?
The canonical SMILES for [2-[methyl(4-phenylbutyl)amino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate is CN(CCCCc1ccccc1)C1CC2CCC1C2OC(=O)C(O)(c1cccs1)c1cccs1.
What is the InChIKey of [2-[methyl(4-phenylbutyl)amino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate?
The InChIKey is WCWYNAZLWINHSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H33NO3S2/c1-29(16-6-5-11-20-9-3-2-4-10-20)23-19-21-14-15-22(23)26(21)32-27(30)28(31,24-12-7-17-33-24)25-13-8-18-34-25/h2-4,7-10,12-13,17-18,21-23,26,31H,5-6,11,14-16,19H2,1H3.
What are the key properties of [2-[methyl(4-phenylbutyl)amino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate?
[2-[methyl(4-phenylbutyl)amino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate has a molecular weight of 495.71 g/mol, XLogP of 5.71, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[methyl(4-phenylbutyl)amino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate is sourced from PubChem (CID 23648974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).