C28H34NO3S2+ — CID 23648976
[7-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-2-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenylpropyl)azanium (PubChem CID 23648976) has the molecular formula C28H34NO3S2+ and a molecular weight of 496.72 g/mol. Its IUPAC name is [7-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-2-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenylpropyl)azanium.
| Compound Name | [7-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-2-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenylpropyl)azanium |
|---|---|
| PubChem CID | 23648976 |
| Molecular Formula | C28H34NO3S2+ |
| Molecular Weight | 496.72 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | [7-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-2-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenylpropyl)azanium |
| SMILES | C[N+](C)(CCCc1ccccc1)C1CC2CCC1C2OC(=O)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C28H34NO3S2/c1-29(2,16-6-11-20-9-4-3-5-10-20)23-19-21-14-15-22(23)26(21)32-27(30)28(31,24-12-7-17-33-24)25-13-8-18-34-25/h3-5,7-10,12-13,17-18,21-23,26,31H,6,11,14-16,19H2,1-2H3/q+1 |
| InChIKey | VRQXDWFTNOCEPV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.72 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|