1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate

C13H9N3O2S — CID 2364899

IUPAC1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate
SMILESO=C(OCc1nc2ccccc2s1)c1cnccn1
InChIInChI=1S/C13H9N3O2S/c17-13(10-7-14-5-6-15-10)18-8-12-16-9-3-1-2-4-11(9)19-12/h1-7H,8H2
InChIKeyGKBOGBQFUNCQJV-UHFFFAOYSA-N
MW271.30 g/mol
LogP2.44
Rot. Bonds3

About 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate

1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate (PubChem CID 2364899) has the molecular formula C13H9N3O2S and a molecular weight of 271.30 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate.

Molecular Properties

Compound Name1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate
PubChem CID2364899
Molecular FormulaC13H9N3O2S
Molecular Weight271.30 g/mol
Exact Mass271.04
IUPAC Name1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate
SMILESO=C(OCc1nc2ccccc2s1)c1cnccn1
InChIInChI=1S/C13H9N3O2S/c17-13(10-7-14-5-6-15-10)18-8-12-16-9-3-1-2-4-11(9)19-12/h1-7H,8H2
InChIKeyGKBOGBQFUNCQJV-UHFFFAOYSA-N
XLogP2.44
TPSA64.97 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.30
LogP ≤ 52.44
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate?
The IUPAC name of 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate (CID 2364899) is 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate.
What is the SMILES notation for 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate?
The canonical SMILES for 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate is O=C(OCc1nc2ccccc2s1)c1cnccn1.
What is the InChIKey of 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate?
The InChIKey is GKBOGBQFUNCQJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O2S/c17-13(10-7-14-5-6-15-10)18-8-12-16-9-3-1-2-4-11(9)19-12/h1-7H,8H2.
What are the key properties of 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate?
1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate has a molecular weight of 271.30 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate is sourced from PubChem (CID 2364899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).