About 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate
1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate (PubChem CID 2364899) has the molecular formula C13H9N3O2S
and a molecular weight of 271.30 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate |
| PubChem CID | 2364899 |
| Molecular Formula | C13H9N3O2S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate |
| SMILES | O=C(OCc1nc2ccccc2s1)c1cnccn1 |
| InChI | InChI=1S/C13H9N3O2S/c17-13(10-7-14-5-6-15-10)18-8-12-16-9-3-1-2-4-11(9)19-12/h1-7H,8H2 |
| InChIKey | GKBOGBQFUNCQJV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate?
The IUPAC name of 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate (CID 2364899) is 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate.
What is the SMILES notation for 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate?
The canonical SMILES for 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate is O=C(OCc1nc2ccccc2s1)c1cnccn1.
What is the InChIKey of 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate?
The InChIKey is GKBOGBQFUNCQJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O2S/c17-13(10-7-14-5-6-15-10)18-8-12-16-9-3-1-2-4-11(9)19-12/h1-7H,8H2.
What are the key properties of 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate?
1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate has a molecular weight of 271.30 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazol-2-ylmethyl pyrazine-2-carboxylate is sourced from PubChem (CID 2364899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).