C29H36NO3S2+ — CID 23649013
[7-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-2-bicyclo[2.2.1]heptanyl]-dimethyl-(4-phenylbutyl)azanium (PubChem CID 23649013) has the molecular formula C29H36NO3S2+ and a molecular weight of 510.75 g/mol. Its IUPAC name is [7-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-2-bicyclo[2.2.1]heptanyl]-dimethyl-(4-phenylbutyl)azanium.
| Compound Name | [7-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-2-bicyclo[2.2.1]heptanyl]-dimethyl-(4-phenylbutyl)azanium |
|---|---|
| PubChem CID | 23649013 |
| Molecular Formula | C29H36NO3S2+ |
| Molecular Weight | 510.75 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | [7-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-2-bicyclo[2.2.1]heptanyl]-dimethyl-(4-phenylbutyl)azanium |
| SMILES | C[N+](C)(CCCCc1ccccc1)C1CC2CCC1C2OC(=O)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C29H36NO3S2/c1-30(2,17-7-6-12-21-10-4-3-5-11-21)24-20-22-15-16-23(24)27(22)33-28(31)29(32,25-13-8-18-34-25)26-14-9-19-35-26/h3-5,8-11,13-14,18-19,22-24,27,32H,6-7,12,15-17,20H2,1-2H3/q+1 |
| InChIKey | FFYTVLMNSIKSSJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.75 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|