C18H17F2N3OS — CID 23649261
3-(2,4-difluorophenyl)-N-[1-(4-methyl-1,3-thiazol-2-yl)piperidin-4-yl]prop-2-ynamide (PubChem CID 23649261) has the molecular formula C18H17F2N3OS and a molecular weight of 361.42 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-N-[1-(4-methyl-1,3-thiazol-2-yl)piperidin-4-yl]prop-2-ynamide.
| Compound Name | 3-(2,4-difluorophenyl)-N-[1-(4-methyl-1,3-thiazol-2-yl)piperidin-4-yl]prop-2-ynamide |
|---|---|
| PubChem CID | 23649261 |
| Molecular Formula | C18H17F2N3OS |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 3-(2,4-difluorophenyl)-N-[1-(4-methyl-1,3-thiazol-2-yl)piperidin-4-yl]prop-2-ynamide |
| SMILES | Cc1csc(N2CCC(NC(=O)C#Cc3ccc(F)cc3F)CC2)n1 |
| InChI | InChI=1S/C18H17F2N3OS/c1-12-11-25-18(21-12)23-8-6-15(7-9-23)22-17(24)5-3-13-2-4-14(19)10-16(13)20/h2,4,10-11,15H,6-9H2,1H3,(H,22,24) |
| InChIKey | RQGIFGNMBVWPSP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|