C19H18N2O4S2 — CID 2364927
1,3-benzothiazol-2-ylmethyl 3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 2364927) has the molecular formula C19H18N2O4S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2364927 |
| Molecular Formula | C19H18N2O4S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCc1nc2ccccc2s1)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C19H18N2O4S2/c22-19(25-13-18-20-16-8-1-2-9-17(16)26-18)14-6-5-7-15(12-14)27(23,24)21-10-3-4-11-21/h1-2,5-9,12H,3-4,10-11,13H2 |
| InChIKey | RRDQHFRGODCRDO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |