C21H35Cl2MnN5 — CID 23649345
dichloromanganese;(4S,9S,14S,19S)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene (PubChem CID 23649345) has the molecular formula C21H35Cl2MnN5 and a molecular weight of 483.39 g/mol. Its IUPAC name is dichloromanganese;(4S,9S,14S,19S)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene.
| Compound Name | dichloromanganese;(4S,9S,14S,19S)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene |
|---|---|
| PubChem CID | 23649345 |
| Molecular Formula | C21H35Cl2MnN5 |
| Molecular Weight | 483.39 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | dichloromanganese;(4S,9S,14S,19S)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene |
| SMILES | Cl[Mn]Cl.c1cc2nc(c1)CN[C@H]1CCCC[C@@H]1NCCN[C@H]1CCCC[C@@H]1NC2 |
| InChI | InChI=1S/C21H35N5.2ClH.Mn/c1-3-10-20-18(8-1)22-12-13-23-19-9-2-4-11-21(19)25-15-17-7-5-6-16(26-17)14-24-20;;;/h5-7,18-25H,1-4,8-15H2;2*1H;/q;;;+2/p-2/t18-,19-,20-,21-;;;/m0.../s1 |
| InChIKey | WXEMWBBXVXHEPU-NDOCQCNASA-L |
| XLogP | 3.45 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |