About [(E,2S)-oct-3-en-2-yl] 2-oxopropanoate
[(E,2S)-oct-3-en-2-yl] 2-oxopropanoate (PubChem CID 23649584) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is [(E,2S)-oct-3-en-2-yl] 2-oxopropanoate.
Molecular Properties
| Compound Name | [(E,2S)-oct-3-en-2-yl] 2-oxopropanoate |
| PubChem CID | 23649584 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | [(E,2S)-oct-3-en-2-yl] 2-oxopropanoate |
| SMILES | CCCC/C=C/[C@H](C)OC(=O)C(C)=O |
| InChI | InChI=1S/C11H18O3/c1-4-5-6-7-8-9(2)14-11(13)10(3)12/h7-9H,4-6H2,1-3H3/b8-7+/t9-/m0/s1 |
| InChIKey | UUZYSECNVWLSHR-FLOXNTQESA-N |
| XLogP | 2.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E,2S)-oct-3-en-2-yl] 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,2S)-oct-3-en-2-yl] 2-oxopropanoate?
The IUPAC name of [(E,2S)-oct-3-en-2-yl] 2-oxopropanoate (CID 23649584) is [(E,2S)-oct-3-en-2-yl] 2-oxopropanoate.
What is the SMILES notation for [(E,2S)-oct-3-en-2-yl] 2-oxopropanoate?
The canonical SMILES for [(E,2S)-oct-3-en-2-yl] 2-oxopropanoate is CCCC/C=C/[C@H](C)OC(=O)C(C)=O.
What is the InChIKey of [(E,2S)-oct-3-en-2-yl] 2-oxopropanoate?
The InChIKey is UUZYSECNVWLSHR-FLOXNTQESA-N. The full InChI is InChI=1S/C11H18O3/c1-4-5-6-7-8-9(2)14-11(13)10(3)12/h7-9H,4-6H2,1-3H3/b8-7+/t9-/m0/s1.
What are the key properties of [(E,2S)-oct-3-en-2-yl] 2-oxopropanoate?
[(E,2S)-oct-3-en-2-yl] 2-oxopropanoate has a molecular weight of 198.26 g/mol, XLogP of 2.25, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,2S)-oct-3-en-2-yl] 2-oxopropanoate is sourced from PubChem (CID 23649584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).