C24H31NO5 — CID 23649902
[(1S,9R,10S,13S)-17-(cyclopropylmethyl)-13-formyl-10-hydroxy-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-yl] acetate (PubChem CID 23649902) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is [(1S,9R,10S,13S)-17-(cyclopropylmethyl)-13-formyl-10-hydroxy-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-yl] acetate.
| Compound Name | [(1S,9R,10S,13S)-17-(cyclopropylmethyl)-13-formyl-10-hydroxy-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-yl] acetate |
|---|---|
| PubChem CID | 23649902 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | [(1S,9R,10S,13S)-17-(cyclopropylmethyl)-13-formyl-10-hydroxy-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-yl] acetate |
| SMILES | COc1ccc2c(c1OC(C)=O)[C@]13CCN(CC4CC4)[C@H](C2)[C@]1(O)CC[C@H](C=O)C3 |
| InChI | InChI=1S/C24H31NO5/c1-15(27)30-22-19(29-2)6-5-18-11-20-24(28)8-7-17(14-26)12-23(24,21(18)22)9-10-25(20)13-16-3-4-16/h5-6,14,16-17,20,28H,3-4,7-13H2,1-2H3/t17-,20+,23+,24+/m0/s1 |
| InChIKey | JTQFXRHPKYAIMI-ZCQFCAMWSA-N |
| XLogP | 2.63 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|