About N-[[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]methyl]methanesulfonamide
N-[[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]methyl]methanesulfonamide (PubChem CID 23650083) has the molecular formula C23H21N3O2S
and a molecular weight of 403.51 g/mol. Its IUPAC name is N-[[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]methyl]methanesulfonamide |
| PubChem CID | 23650083 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-[[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C23H21N3O2S/c1-29(27,28)24-16-17-12-14-20(15-13-17)23-25-21(18-8-4-2-5-9-18)22(26-23)19-10-6-3-7-11-19/h2-15,24H,16H2,1H3,(H,25,26) |
| InChIKey | DTVBAIMJCGZVFO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze N-[[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]methyl]methanesulfonamide?
The IUPAC name of N-[[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]methyl]methanesulfonamide (CID 23650083) is N-[[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]methyl]methanesulfonamide.
What is the SMILES notation for N-[[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]methyl]methanesulfonamide?
The canonical SMILES for N-[[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]methyl]methanesulfonamide is CS(=O)(=O)NCc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1.
What is the InChIKey of N-[[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]methyl]methanesulfonamide?
The InChIKey is DTVBAIMJCGZVFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3O2S/c1-29(27,28)24-16-17-12-14-20(15-13-17)23-25-21(18-8-4-2-5-9-18)22(26-23)19-10-6-3-7-11-19/h2-15,24H,16H2,1H3,(H,25,26).
What are the key properties of N-[[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]methyl]methanesulfonamide?
N-[[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]methyl]methanesulfonamide has a molecular weight of 403.51 g/mol, XLogP of 4.46, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]methyl]methanesulfonamide is sourced from PubChem (CID 23650083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).